C22H29FN6O — CID 111395791
1-[3-[[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 111395791) has the molecular formula C22H29FN6O and a molecular weight of 412.51 g/mol. Its IUPAC name is 1-[3-[[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111395791 |
| Molecular Formula | C22H29FN6O |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-[3-[[[N-[2-(3-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | C/N=C(\NCCc1cccc(F)c1)NCc1cccnc1N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C22H29FN6O/c1-25-22(27-11-9-16-5-2-8-19(23)13-16)28-14-17-6-3-10-26-21(17)29-12-4-7-18(15-29)20(24)30/h2-3,5-6,8,10,13,18H,4,7,9,11-12,14-15H2,1H3,(H2,24,30)(H2,25,27,28) |
| InChIKey | KSHIZHGEFNLKEP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|