C24H34FIN6O — CID 111625199
1-[3-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111625199) has the molecular formula C24H34FIN6O and a molecular weight of 568.48 g/mol. Its IUPAC name is 1-[3-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111625199 |
| Molecular Formula | C24H34FIN6O |
| Molecular Weight | 568.48 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | 1-[3-[[[N-[2-(3-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccnc1N1CCCC(C(N)=O)C1)NCC(C)(C)c1cccc(F)c1.I |
| InChI | InChI=1S/C24H33FN6O.HI/c1-24(2,19-9-4-10-20(25)13-19)16-30-23(27-3)29-14-17-7-5-11-28-22(17)31-12-6-8-18(15-31)21(26)32;/h4-5,7,9-11,13,18H,6,8,12,14-16H2,1-3H3,(H2,26,32)(H2,27,29,30);1H |
| InChIKey | CKEAWICZXLLCLL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|