C19H32N6OS — CID 111626458
1-[3-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 111626458) has the molecular formula C19H32N6OS and a molecular weight of 392.57 g/mol. Its IUPAC name is 1-[3-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111626458 |
| Molecular Formula | C19H32N6OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 1-[3-[[[N'-methyl-N-(4-methylsulfanylbutyl)carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | C/N=C(\NCCCCSC)NCc1cccnc1N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C19H32N6OS/c1-21-19(23-9-3-4-13-27-2)24-14-16-6-5-10-22-18(16)25-11-7-15(8-12-25)17(20)26/h5-6,10,15H,3-4,7-9,11-14H2,1-2H3,(H2,20,26)(H2,21,23,24) |
| InChIKey | SYTXCMWIDVXKFR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|