C21H31N7O2 — CID 111584476
1-[3-[[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 111584476) has the molecular formula C21H31N7O2 and a molecular weight of 413.53 g/mol. Its IUPAC name is 1-[3-[[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111584476 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 1-[3-[[[N'-methyl-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | C/N=C(\NCc1cc(C(C)C)no1)NCc1cccnc1N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C21H31N7O2/c1-14(2)18-11-17(30-27-18)13-26-21(23-3)25-12-16-5-4-8-24-20(16)28-9-6-15(7-10-28)19(22)29/h4-5,8,11,14-15H,6-7,9-10,12-13H2,1-3H3,(H2,22,29)(H2,23,25,26) |
| InChIKey | ZQFRWHSYCIWBLA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 121.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|