C23H33IN6OS — CID 111299012
1-[3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111299012) has the molecular formula C23H33IN6OS and a molecular weight of 568.53 g/mol. Its IUPAC name is 1-[3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111299012 |
| Molecular Formula | C23H33IN6OS |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 1-[3-[[[N,N'-dimethyl-N-[(4-methylsulfanylphenyl)methyl]carbamimidoyl]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1cccnc1N1CCCC(C(N)=O)C1)N(C)Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C23H32N6OS.HI/c1-25-23(28(2)15-17-8-10-20(31-3)11-9-17)27-14-18-6-4-12-26-22(18)29-13-5-7-19(16-29)21(24)30;/h4,6,8-12,19H,5,7,13-16H2,1-3H3,(H2,24,30)(H,25,27);1H |
| InChIKey | NQMBGAYPPJZDQF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 86.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|