C18H27N5O2 — CID 166217241
1-[3-[[(2-methylpyrrolidine-1-carbonyl)amino]methyl]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 166217241) has the molecular formula C18H27N5O2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-[3-[[(2-methylpyrrolidine-1-carbonyl)amino]methyl]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[(2-methylpyrrolidine-1-carbonyl)amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 166217241 |
| Molecular Formula | C18H27N5O2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.22 |
| IUPAC Name | 1-[3-[[(2-methylpyrrolidine-1-carbonyl)amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | CC1CCCN1C(=O)NCc1cccnc1N1CCCC(C(N)=O)C1 |
| InChI | InChI=1S/C18H27N5O2/c1-13-5-3-10-23(13)18(25)21-11-14-6-2-8-20-17(14)22-9-4-7-15(12-22)16(19)24/h2,6,8,13,15H,3-5,7,9-12H2,1H3,(H2,19,24)(H,21,25) |
| InChIKey | XBRRAKNYOAIFMA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |