C22H29ClN6O — CID 111174110
1-[3-[[[[(2-chlorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide (PubChem CID 111174110) has the molecular formula C22H29ClN6O and a molecular weight of 428.97 g/mol. Its IUPAC name is 1-[3-[[[[(2-chlorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide.
| Compound Name | 1-[3-[[[[(2-chlorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 111174110 |
| Molecular Formula | C22H29ClN6O |
| Molecular Weight | 428.97 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 1-[3-[[[[(2-chlorophenyl)methylamino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCCC(C(N)=O)C1)NCc1ccccc1Cl |
| InChI | InChI=1S/C22H29ClN6O/c1-2-25-22(27-13-16-7-3-4-10-19(16)23)28-14-17-8-5-11-26-21(17)29-12-6-9-18(15-29)20(24)30/h3-5,7-8,10-11,18H,2,6,9,12-15H2,1H3,(H2,24,30)(H2,25,27,28) |
| InChIKey | PZRZTBGZAHPEIR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.97 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|