C20H35IN6O — CID 111128546
1-[3-[[[ethylamino-(pentylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111128546) has the molecular formula C20H35IN6O and a molecular weight of 502.45 g/mol. Its IUPAC name is 1-[3-[[[ethylamino-(pentylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[ethylamino-(pentylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111128546 |
| Molecular Formula | C20H35IN6O |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 1-[3-[[[ethylamino-(pentylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | CCCCCN/C(=N/Cc1cccnc1N1CCCC(C(N)=O)C1)NCC.I |
| InChI | InChI=1S/C20H34N6O.HI/c1-3-5-6-11-24-20(22-4-2)25-14-16-9-7-12-23-19(16)26-13-8-10-17(15-26)18(21)27;/h7,9,12,17H,3-6,8,10-11,13-15H2,1-2H3,(H2,21,27)(H2,22,24,25);1H |
| InChIKey | AEQGNAGVJNIUKJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|