C21H34IN7O2 — CID 111928131
1-[3-[[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111928131) has the molecular formula C21H34IN7O2 and a molecular weight of 543.45 g/mol. Its IUPAC name is 1-[3-[[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111928131 |
| Molecular Formula | C21H34IN7O2 |
| Molecular Weight | 543.45 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 1-[3-[[[[2-(cyclopropanecarbonylamino)ethylamino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCC(C(N)=O)CC1)NCCNC(=O)C1CC1.I |
| InChI | InChI=1S/C21H33N7O2.HI/c1-2-23-21(26-11-10-25-20(30)16-5-6-16)27-14-17-4-3-9-24-19(17)28-12-7-15(8-13-28)18(22)29;/h3-4,9,15-16H,2,5-8,10-14H2,1H3,(H2,22,29)(H,25,30)(H2,23,26,27);1H |
| InChIKey | ZDRYGZRFPNKCEH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 124.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|