C23H41IN6O2 — CID 111717621
1-[3-[[[[(3-ethoxy-4-methylpentyl)amino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111717621) has the molecular formula C23H41IN6O2 and a molecular weight of 560.53 g/mol. Its IUPAC name is 1-[3-[[[[(3-ethoxy-4-methylpentyl)amino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[[(3-ethoxy-4-methylpentyl)amino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111717621 |
| Molecular Formula | C23H41IN6O2 |
| Molecular Weight | 560.53 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 1-[3-[[[[(3-ethoxy-4-methylpentyl)amino]-(ethylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCC(C(N)=O)CC1)NCCC(OCC)C(C)C.I |
| InChI | InChI=1S/C23H40N6O2.HI/c1-5-25-23(27-13-9-20(17(3)4)31-6-2)28-16-19-8-7-12-26-22(19)29-14-10-18(11-15-29)21(24)30;/h7-8,12,17-18,20H,5-6,9-11,13-16H2,1-4H3,(H2,24,30)(H2,25,27,28);1H |
| InChIKey | SVBMNOJWWBJBLU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|