C20H35IN6O2 — CID 111605982
1-[3-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111605982) has the molecular formula C20H35IN6O2 and a molecular weight of 518.44 g/mol. Its IUPAC name is 1-[3-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111605982 |
| Molecular Formula | C20H35IN6O2 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | 1-[3-[[[ethylamino-[(2-methoxy-2-methylpropyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCC(C(N)=O)CC1)NCC(C)(C)OC.I |
| InChI | InChI=1S/C20H34N6O2.HI/c1-5-22-19(25-14-20(2,3)28-4)24-13-16-7-6-10-23-18(16)26-11-8-15(9-12-26)17(21)27;/h6-7,10,15H,5,8-9,11-14H2,1-4H3,(H2,21,27)(H2,22,24,25);1H |
| InChIKey | FTSUUTZCBBHBGH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 104.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|