C22H34N8O — CID 111952721
1-[3-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 111952721) has the molecular formula C22H34N8O and a molecular weight of 426.57 g/mol. Its IUPAC name is 1-[3-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111952721 |
| Molecular Formula | C22H34N8O |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 1-[3-[[[ethylamino-[(1,3,5-trimethylpyrazol-4-yl)methylamino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCC(C(N)=O)CC1)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C22H34N8O/c1-5-24-22(27-14-19-15(2)28-29(4)16(19)3)26-13-18-7-6-10-25-21(18)30-11-8-17(9-12-30)20(23)31/h6-7,10,17H,5,8-9,11-14H2,1-4H3,(H2,23,31)(H2,24,26,27) |
| InChIKey | SATHUZDBZSMPOF-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|