C24H35IN6O — CID 111635325
1-[3-[[[ethylamino-[(2-ethylphenyl)methylamino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111635325) has the molecular formula C24H35IN6O and a molecular weight of 550.49 g/mol. Its IUPAC name is 1-[3-[[[ethylamino-[(2-ethylphenyl)methylamino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[ethylamino-[(2-ethylphenyl)methylamino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111635325 |
| Molecular Formula | C24H35IN6O |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.19 |
| IUPAC Name | 1-[3-[[[ethylamino-[(2-ethylphenyl)methylamino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCC(C(N)=O)CC1)NCc1ccccc1CC.I |
| InChI | InChI=1S/C24H34N6O.HI/c1-3-18-8-5-6-9-20(18)16-28-24(26-4-2)29-17-21-10-7-13-27-23(21)30-14-11-19(12-15-30)22(25)31;/h5-10,13,19H,3-4,11-12,14-17H2,1-2H3,(H2,25,31)(H2,26,28,29);1H |
| InChIKey | YDJVQKWZQTXEBD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|