C23H35IN6OS — CID 111673195
1-[3-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111673195) has the molecular formula C23H35IN6OS and a molecular weight of 570.55 g/mol. Its IUPAC name is 1-[3-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111673195 |
| Molecular Formula | C23H35IN6OS |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | 1-[3-[[[ethylamino-[(2-methyl-3-thiophen-2-ylpropyl)amino]methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCC(C(N)=O)CC1)NCC(C)Cc1cccs1.I |
| InChI | InChI=1S/C23H34N6OS.HI/c1-3-25-23(27-15-17(2)14-20-7-5-13-31-20)28-16-19-6-4-10-26-22(19)29-11-8-18(9-12-29)21(24)30;/h4-7,10,13,17-18H,3,8-9,11-12,14-16H2,1-2H3,(H2,24,30)(H2,25,27,28);1H |
| InChIKey | JSCHMJMCFUCPSQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|