C21H33IN8O — CID 111905958
1-[3-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111905958) has the molecular formula C21H33IN8O and a molecular weight of 540.45 g/mol. Its IUPAC name is 1-[3-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111905958 |
| Molecular Formula | C21H33IN8O |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 540.18 |
| IUPAC Name | 1-[3-[[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCC(C(N)=O)CC1)NCCCn1cccn1.I |
| InChI | InChI=1S/C21H32N8O.HI/c1-2-23-21(25-10-4-12-29-13-5-11-27-29)26-16-18-6-3-9-24-20(18)28-14-7-17(8-15-28)19(22)30;/h3,5-6,9,11,13,17H,2,4,7-8,10,12,14-16H2,1H3,(H2,22,30)(H2,23,25,26);1H |
| InChIKey | PHSYFVMZMXTTPU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|