C17H28N6O — CID 111100567
1-[3-[[[amino(butylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide (PubChem CID 111100567) has the molecular formula C17H28N6O and a molecular weight of 332.45 g/mol. Its IUPAC name is 1-[3-[[[amino(butylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-[[[amino(butylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111100567 |
| Molecular Formula | C17H28N6O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 1-[3-[[[amino(butylamino)methylidene]amino]methyl]-2-pyridinyl]piperidine-4-carboxamide |
| SMILES | CCCCN/C(N)=N/Cc1cccnc1N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H28N6O/c1-2-3-8-21-17(19)22-12-14-5-4-9-20-16(14)23-10-6-13(7-11-23)15(18)24/h4-5,9,13H,2-3,6-8,10-12H2,1H3,(H2,18,24)(H3,19,21,22) |
| InChIKey | HZSNAZKSGYASPI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|