C22H29F3IN5O — CID 111300022
3-ethyl-1-methyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111300022) has the molecular formula C22H29F3IN5O and a molecular weight of 563.41 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111300022 |
| Molecular Formula | C22H29F3IN5O |
| Molecular Weight | 563.41 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 3-ethyl-1-methyl-2-[(2-morpholin-4-yl-3-pyridinyl)methyl]-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCOCC1)N(C)Cc1ccc(C(F)(F)F)cc1.I |
| InChI | InChI=1S/C22H28F3N5O.HI/c1-3-26-21(29(2)16-17-6-8-19(9-7-17)22(23,24)25)28-15-18-5-4-10-27-20(18)30-11-13-31-14-12-30;/h4-10H,3,11-16H2,1-2H3,(H,26,28);1H |
| InChIKey | RPSZISOCLYYAMG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|