C22H31FN6 — CID 111306517
3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 111306517) has the molecular formula C22H31FN6 and a molecular weight of 398.53 g/mol. Its IUPAC name is 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111306517 |
| Molecular Formula | C22H31FN6 |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[[2-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1N1CCN(C)CC1)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H31FN6/c1-4-24-22(28(3)17-18-7-9-20(23)10-8-18)26-16-19-6-5-11-25-21(19)29-14-12-27(2)13-15-29/h5-11H,4,12-17H2,1-3H3,(H,24,26) |
| InChIKey | AXVCKUBWIPRVQR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|