C21H28FN5 — CID 111307148
3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111307148) has the molecular formula C21H28FN5 and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111307148 |
| Molecular Formula | C21H28FN5 |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[(2-pyrrolidin-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(N2CCCC2)c1)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H28FN5/c1-3-23-21(26(2)16-17-6-8-19(22)9-7-17)25-15-18-10-11-24-20(14-18)27-12-4-5-13-27/h6-11,14H,3-5,12-13,15-16H2,1-2H3,(H,23,25) |
| InChIKey | XVAGSXPOXGQMRQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|