C23H31F2IN4O — CID 111307665
3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111307665) has the molecular formula C23H31F2IN4O and a molecular weight of 544.43 g/mol. Its IUPAC name is 3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111307665 |
| Molecular Formula | C23H31F2IN4O |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 3-ethyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C23H30F2N4O.HI/c1-3-26-23(28(2)16-17-4-7-19(24)8-5-17)27-15-18-6-9-22(21(25)14-18)29-12-10-20(30)11-13-29;/h4-9,14,20,30H,3,10-13,15-16H2,1-2H3,(H,26,27);1H |
| InChIKey | BAVMIAKEKRHGHC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|