C22H29FN4O — CID 111068451
3-benzyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1,1-dimethylguanidine (PubChem CID 111068451) has the molecular formula C22H29FN4O and a molecular weight of 384.50 g/mol. Its IUPAC name is 3-benzyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1,1-dimethylguanidine.
| Compound Name | 3-benzyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111068451 |
| Molecular Formula | C22H29FN4O |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 3-benzyl-2-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N\Cc1ccc(N2CCC(O)CC2)c(F)c1)NCc1ccccc1 |
| InChI | InChI=1S/C22H29FN4O/c1-26(2)22(24-15-17-6-4-3-5-7-17)25-16-18-8-9-21(20(23)14-18)27-12-10-19(28)11-13-27/h3-9,14,19,28H,10-13,15-16H2,1-2H3,(H,24,25) |
| InChIKey | IQKXDHSBJNQHGR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|