C21H27F2IN4 — CID 111084730
2-benzyl-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1,1-dimethylguanidine;hydroiodide (PubChem CID 111084730) has the molecular formula C21H27F2IN4 and a molecular weight of 500.38 g/mol. Its IUPAC name is 2-benzyl-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1,1-dimethylguanidine;hydroiodide.
| Compound Name | 2-benzyl-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1,1-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111084730 |
| Molecular Formula | C21H27F2IN4 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 2-benzyl-3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1,1-dimethylguanidine;hydroiodide |
| SMILES | CN(C)/C(=N\Cc1ccccc1)NCC1CCN(c2ccc(F)c(F)c2)C1.I |
| InChI | InChI=1S/C21H26F2N4.HI/c1-26(2)21(24-13-16-6-4-3-5-7-16)25-14-17-10-11-27(15-17)18-8-9-19(22)20(23)12-18;/h3-9,12,17H,10-11,13-15H2,1-2H3,(H,24,25);1H |
| InChIKey | VEAOAAIMNUOPGP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|