C20H23F2N3O2 — CID 71884624
3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-[(2-hydroxyphenyl)methyl]-1-methylurea (PubChem CID 71884624) has the molecular formula C20H23F2N3O2 and a molecular weight of 375.42 g/mol. Its IUPAC name is 3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-[(2-hydroxyphenyl)methyl]-1-methylurea.
| Compound Name | 3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-[(2-hydroxyphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 71884624 |
| Molecular Formula | C20H23F2N3O2 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-1-[(2-hydroxyphenyl)methyl]-1-methylurea |
| SMILES | CN(Cc1ccccc1O)C(=O)NCC1CCN(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-24(13-15-4-2-3-5-19(15)26)20(27)23-11-14-8-9-25(12-14)16-6-7-17(21)18(22)10-16/h2-7,10,14,26H,8-9,11-13H2,1H3,(H,23,27) |
| InChIKey | NKDONKIKAZZSLK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|