C17H20F2N2O — CID 51093935
(2E,4E)-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]hexa-2,4-dienamide (PubChem CID 51093935) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is (2E,4E)-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 51093935 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (2E,4E)-N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCC1CCN(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C17H20F2N2O/c1-2-3-4-5-17(22)20-11-13-8-9-21(12-13)14-6-7-15(18)16(19)10-14/h2-7,10,13H,8-9,11-12H2,1H3,(H,20,22)/b3-2+,5-4+ |
| InChIKey | TWTSBODZSOIZCH-MQQKCMAXSA-N |
| XLogP | 3.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|