C20H22F2N2O3 — CID 51126349
N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3,4-dimethoxybenzamide (PubChem CID 51126349) has the molecular formula C20H22F2N2O3 and a molecular weight of 376.40 g/mol. Its IUPAC name is N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 51126349 |
| Molecular Formula | C20H22F2N2O3 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC2CCN(c3ccc(F)c(F)c3)C2)cc1OC |
| InChI | InChI=1S/C20H22F2N2O3/c1-26-18-6-3-14(9-19(18)27-2)20(25)23-11-13-7-8-24(12-13)15-4-5-16(21)17(22)10-15/h3-6,9-10,13H,7-8,11-12H2,1-2H3,(H,23,25) |
| InChIKey | QNOHYZRTODZSRQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |