C22H25F3N4O2 — CID 86937278
N-[3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]propyl]-3-fluorobenzamide (PubChem CID 86937278) has the molecular formula C22H25F3N4O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is N-[3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]propyl]-3-fluorobenzamide.
| Compound Name | N-[3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]propyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 86937278 |
| Molecular Formula | C22H25F3N4O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | N-[3-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methylcarbamoylamino]propyl]-3-fluorobenzamide |
| SMILES | O=C(NCCCNC(=O)c1cccc(F)c1)NCC1CCN(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C22H25F3N4O2/c23-17-4-1-3-16(11-17)21(30)26-8-2-9-27-22(31)28-13-15-7-10-29(14-15)18-5-6-19(24)20(25)12-18/h1,3-6,11-12,15H,2,7-10,13-14H2,(H,26,30)(H2,27,28,31) |
| InChIKey | JNCWCRSIMJRDHS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|