C16H20F2N2OS — CID 94812888
N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-prop-2-enylsulfanylacetamide (PubChem CID 94812888) has the molecular formula C16H20F2N2OS and a molecular weight of 326.41 g/mol. Its IUPAC name is N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-prop-2-enylsulfanylacetamide.
| Compound Name | N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-prop-2-enylsulfanylacetamide |
|---|---|
| PubChem CID | 94812888 |
| Molecular Formula | C16H20F2N2OS |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[[(3S)-1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-2-prop-2-enylsulfanylacetamide |
| SMILES | C=CCSCC(=O)NC[C@@H]1CCN(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C16H20F2N2OS/c1-2-7-22-11-16(21)19-9-12-5-6-20(10-12)13-3-4-14(17)15(18)8-13/h2-4,8,12H,1,5-7,9-11H2,(H,19,21)/t12-/m0/s1 |
| InChIKey | DDVKGRAZJFBXMK-LBPRGKRZSA-N |
| XLogP | 2.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|