C23H31F2IN4O — CID 109418427
1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide (PubChem CID 109418427) has the molecular formula C23H31F2IN4O and a molecular weight of 544.43 g/mol. Its IUPAC name is 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109418427 |
| Molecular Formula | C23H31F2IN4O |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-(2-hydroxy-2-phenylpropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NCC1CCN(c2ccc(F)c(F)c2)C1.I |
| InChI | InChI=1S/C23H30F2N4O.HI/c1-3-26-22(28-16-23(2,30)18-7-5-4-6-8-18)27-14-17-11-12-29(15-17)19-9-10-20(24)21(25)13-19;/h4-10,13,17,30H,3,11-12,14-16H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | WGINQNBTUFUJCE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|