C23H37F2IN4O — CID 109477928
1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide (PubChem CID 109477928) has the molecular formula C23H37F2IN4O and a molecular weight of 550.48 g/mol. Its IUPAC name is 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109477928 |
| Molecular Formula | C23H37F2IN4O |
| Molecular Weight | 550.48 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 1-[[1-(3,4-difluorophenyl)pyrrolidin-3-yl]methyl]-3-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCC1CCN(c2ccc(F)c(F)c2)C1.I |
| InChI | InChI=1S/C23H36F2N4O.HI/c1-2-26-22(28-17-23(11-13-30)9-4-3-5-10-23)27-15-18-8-12-29(16-18)19-6-7-20(24)21(25)14-19;/h6-7,14,18,30H,2-5,8-13,15-17H2,1H3,(H2,26,27,28);1H |
| InChIKey | FNJDKOCOFPUFRI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|