C24H43N5OS — CID 109477432
1-ethyl-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine (PubChem CID 109477432) has the molecular formula C24H43N5OS and a molecular weight of 449.71 g/mol. Its IUPAC name is 1-ethyl-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
|---|---|
| PubChem CID | 109477432 |
| Molecular Formula | C24H43N5OS |
| Molecular Weight | 449.71 g/mol |
| Exact Mass | 449.32 |
| IUPAC Name | 1-ethyl-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]guanidine |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCC1CCN(Cc2csc(CC)n2)CC1 |
| InChI | InChI=1S/C24H43N5OS/c1-3-22-28-21(18-31-22)17-29-13-8-20(9-14-29)16-26-23(25-4-2)27-19-24(12-15-30)10-6-5-7-11-24/h18,20,30H,3-17,19H2,1-2H3,(H2,25,26,27) |
| InChIKey | NKZADMONDLMMOH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.71 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|