C21H38IN5OS — CID 109477247
1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 109477247) has the molecular formula C21H38IN5OS and a molecular weight of 535.54 g/mol. Its IUPAC name is 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109477247 |
| Molecular Formula | C21H38IN5OS |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 1-ethyl-2-[[1-(2-hydroxyethyl)cyclohexyl]methyl]-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(CCO)CCCCC1)NCCc1csc(N2CCCC2)n1.I |
| InChI | InChI=1S/C21H37N5OS.HI/c1-2-22-19(24-17-21(11-15-27)9-4-3-5-10-21)23-12-8-18-16-28-20(25-18)26-13-6-7-14-26;/h16,27H,2-15,17H2,1H3,(H2,22,23,24);1H |
| InChIKey | ZSVXZFCVJUBSRU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|