C21H39IN6S — CID 111830456
1-ethyl-2-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111830456) has the molecular formula C21H39IN6S and a molecular weight of 534.56 g/mol. Its IUPAC name is 1-ethyl-2-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111830456 |
| Molecular Formula | C21H39IN6S |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 1-ethyl-2-(2-methyl-2-piperidin-1-ylpropyl)-3-[2-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)N1CCCCC1)NCCc1csc(N2CCCC2)n1.I |
| InChI | InChI=1S/C21H38N6S.HI/c1-4-22-19(24-17-21(2,3)27-14-6-5-7-15-27)23-11-10-18-16-28-20(25-18)26-12-8-9-13-26;/h16H,4-15,17H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | NVRHETBNFHNVEU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|