C18H33N5S — CID 111832837
1-ethyl-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine (PubChem CID 111832837) has the molecular formula C18H33N5S and a molecular weight of 351.56 g/mol. Its IUPAC name is 1-ethyl-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111832837 |
| Molecular Formula | C18H33N5S |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | 1-ethyl-2-[(2-ethyl-1,3-thiazol-4-yl)methyl]-3-(2-methyl-2-piperidin-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\Cc1csc(CC)n1)NCC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C18H33N5S/c1-5-16-22-15(13-24-16)12-20-17(19-6-2)21-14-18(3,4)23-10-8-7-9-11-23/h13H,5-12,14H2,1-4H3,(H2,19,20,21) |
| InChIKey | GXPUKXPZNXCWBF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|