C16H30N6 — CID 111320616
1-ethyl-3-(2-methyl-2-piperidin-1-ylpropyl)-2-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111320616) has the molecular formula C16H30N6 and a molecular weight of 306.46 g/mol. Its IUPAC name is 1-ethyl-3-(2-methyl-2-piperidin-1-ylpropyl)-2-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-(2-methyl-2-piperidin-1-ylpropyl)-2-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111320616 |
| Molecular Formula | C16H30N6 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 1-ethyl-3-(2-methyl-2-piperidin-1-ylpropyl)-2-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCC(C)(C)N1CCCCC1 |
| InChI | InChI=1S/C16H30N6/c1-4-17-15(18-12-14-8-9-20-21-14)19-13-16(2,3)22-10-6-5-7-11-22/h8-9H,4-7,10-13H2,1-3H3,(H,20,21)(H2,17,18,19) |
| InChIKey | JONXXNHARDPWFN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|