C14H22IN5O2 — CID 111671513
1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111671513) has the molecular formula C14H22IN5O2 and a molecular weight of 419.27 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111671513 |
| Molecular Formula | C14H22IN5O2 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCC(C)(O)c1ccco1.I |
| InChI | InChI=1S/C14H21N5O2.HI/c1-3-15-13(16-9-11-6-7-18-19-11)17-10-14(2,20)12-5-4-8-21-12;/h4-8,20H,3,9-10H2,1-2H3,(H,18,19)(H2,15,16,17);1H |
| InChIKey | NYEYATJYYMQUDQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|