C20H27F3IN3O3 — CID 111672345
1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111672345) has the molecular formula C20H27F3IN3O3 and a molecular weight of 541.35 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111672345 |
| Molecular Formula | C20H27F3IN3O3 |
| Molecular Weight | 541.35 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCC(C)(O)c1ccco1.I |
| InChI | InChI=1S/C20H26F3N3O3.HI/c1-3-24-18(26-13-19(2,27)17-5-4-10-29-17)25-11-15-6-8-16(9-7-15)12-28-14-20(21,22)23;/h4-10,27H,3,11-14H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | YCIPVPWFCNXGJQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.35 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|