C18H25F6N3O2 — CID 111856938
1-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine (PubChem CID 111856938) has the molecular formula C18H25F6N3O2 and a molecular weight of 429.41 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111856938 |
| Molecular Formula | C18H25F6N3O2 |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 1-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]-3-[3-(2,2,2-trifluoroethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C18H25F6N3O2/c1-2-25-16(26-8-3-9-28-12-17(19,20)21)27-10-14-4-6-15(7-5-14)11-29-13-18(22,23)24/h4-7H,2-3,8-13H2,1H3,(H2,25,26,27) |
| InChIKey | DTIUUKOPMAQLLD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|