C21H34F3N3O3 — CID 111693714
1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111693714) has the molecular formula C21H34F3N3O3 and a molecular weight of 433.52 g/mol. Its IUPAC name is 1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111693714 |
| Molecular Formula | C21H34F3N3O3 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 1-[2-(2-butoxyethoxy)ethyl]-3-ethyl-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCCCOCCOCCN/C(=N/Cc1ccc(COCC(F)(F)F)cc1)NCC |
| InChI | InChI=1S/C21H34F3N3O3/c1-3-5-11-28-13-14-29-12-10-26-20(25-4-2)27-15-18-6-8-19(9-7-18)16-30-17-21(22,23)24/h6-9H,3-5,10-17H2,1-2H3,(H2,25,26,27) |
| InChIKey | PHBPCLVOVRTEPV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|