C22H34F3N3O3 — CID 111644220
1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111644220) has the molecular formula C22H34F3N3O3 and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111644220 |
| Molecular Formula | C22H34F3N3O3 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCCCOCC1CCOCC1 |
| InChI | InChI=1S/C22H34F3N3O3/c1-2-26-21(27-10-3-11-30-15-20-8-12-29-13-9-20)28-14-18-4-6-19(7-5-18)16-31-17-22(23,24)25/h4-7,20H,2-3,8-17H2,1H3,(H2,26,27,28) |
| InChIKey | WAAJQAZXYCOQLI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|