C20H32F3N3O2 — CID 111402443
1-ethyl-3-[3-(2-methylpropoxy)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine (PubChem CID 111402443) has the molecular formula C20H32F3N3O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2-methylpropoxy)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[3-(2-methylpropoxy)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111402443 |
| Molecular Formula | C20H32F3N3O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 1-ethyl-3-[3-(2-methylpropoxy)propyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCCCOCC(C)C |
| InChI | InChI=1S/C20H32F3N3O2/c1-4-24-19(25-10-5-11-27-13-16(2)3)26-12-17-6-8-18(9-7-17)14-28-15-20(21,22)23/h6-9,16H,4-5,10-15H2,1-3H3,(H2,24,25,26) |
| InChIKey | DJEIUQQKSHQWEG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|