C20H25F3N4O3 — CID 111857825
N-[2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 111857825) has the molecular formula C20H25F3N4O3 and a molecular weight of 426.44 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111857825 |
| Molecular Formula | C20H25F3N4O3 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]carbamimidoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C20H25F3N4O3/c1-2-24-19(26-10-9-25-18(28)17-4-3-11-30-17)27-12-15-5-7-16(8-6-15)13-29-14-20(21,22)23/h3-8,11H,2,9-10,12-14H2,1H3,(H,25,28)(H2,24,26,27) |
| InChIKey | FGTDCIFBPWAMKH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|