C18H24F3IN4O3 — CID 111672656
1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111672656) has the molecular formula C18H24F3IN4O3 and a molecular weight of 528.31 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111672656 |
| Molecular Formula | C18H24F3IN4O3 |
| Molecular Weight | 528.31 g/mol |
| Exact Mass | 528.08 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCC(F)(F)F)NCC(C)(O)c1ccco1.I |
| InChI | InChI=1S/C18H23F3N4O3.HI/c1-3-22-16(25-11-17(2,26)14-7-5-9-27-14)24-10-13-6-4-8-23-15(13)28-12-18(19,20)21;/h4-9,26H,3,10-12H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | CZCDOVBMSYXCNP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|