C25H30N4O2 — CID 109417046
1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine (PubChem CID 109417046) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 109417046 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-phenylpropyl)-2-[(2-phenylmethoxy-3-pyridinyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1OCc1ccccc1)NCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C25H30N4O2/c1-3-26-24(29-19-25(2,30)22-14-8-5-9-15-22)28-17-21-13-10-16-27-23(21)31-18-20-11-6-4-7-12-20/h4-16,30H,3,17-19H2,1-2H3,(H2,26,28,29) |
| InChIKey | JWLAWWPUPYZADN-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|