C19H30N6O2 — CID 111656084
1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(2-propoxy-3-pyridinyl)methyl]guanidine (PubChem CID 111656084) has the molecular formula C19H30N6O2 and a molecular weight of 374.49 g/mol. Its IUPAC name is 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(2-propoxy-3-pyridinyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(2-propoxy-3-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111656084 |
| Molecular Formula | C19H30N6O2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-[(2-propoxy-3-pyridinyl)methyl]guanidine |
| SMILES | CCCOc1ncccc1C/N=C(\NCC)NCC(C)(O)c1cnn(C)c1 |
| InChI | InChI=1S/C19H30N6O2/c1-5-10-27-17-15(8-7-9-21-17)11-22-18(20-6-2)23-14-19(3,26)16-12-24-25(4)13-16/h7-9,12-13,26H,5-6,10-11,14H2,1-4H3,(H2,20,22,23) |
| InChIKey | LXLXJTRSYLFJFQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|