C21H32N6O2 — CID 111656128
2-[(2-cyclopentyloxy-3-pyridinyl)methyl]-1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine (PubChem CID 111656128) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxy-3-pyridinyl)methyl]-1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine.
| Compound Name | 2-[(2-cyclopentyloxy-3-pyridinyl)methyl]-1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111656128 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-[(2-cyclopentyloxy-3-pyridinyl)methyl]-1-ethyl-3-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccnc1OC1CCCC1)NCC(C)(O)c1cnn(C)c1 |
| InChI | InChI=1S/C21H32N6O2/c1-4-22-20(25-15-21(2,28)17-13-26-27(3)14-17)24-12-16-8-7-11-23-19(16)29-18-9-5-6-10-18/h7-8,11,13-14,18,28H,4-6,9-10,12,15H2,1-3H3,(H2,22,24,25) |
| InChIKey | HEIRBLVRZFFTAP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|