C20H25IN4O2S — CID 111672079
1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111672079) has the molecular formula C20H25IN4O2S and a molecular weight of 512.42 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111672079 |
| Molecular Formula | C20H25IN4O2S |
| Molecular Weight | 512.42 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-yl)-2-hydroxypropyl]-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nc(-c2ccccc2)cs1)NCC(C)(O)c1ccco1.I |
| InChI | InChI=1S/C20H24N4O2S.HI/c1-3-21-19(23-14-20(2,25)17-10-7-11-26-17)22-12-18-24-16(13-27-18)15-8-5-4-6-9-15;/h4-11,13,25H,3,12,14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | FRJKEBWWEWITQQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 82.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|