C22H32FN5S — CID 111764639
1-ethyl-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-[(2-fluorophenyl)methyl]guanidine (PubChem CID 111764639) has the molecular formula C22H32FN5S and a molecular weight of 417.60 g/mol. Its IUPAC name is 1-ethyl-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-[(2-fluorophenyl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-[(2-fluorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111764639 |
| Molecular Formula | C22H32FN5S |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-ethyl-3-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-2-[(2-fluorophenyl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1F)NCC1CCN(Cc2csc(CC)n2)CC1 |
| InChI | InChI=1S/C22H32FN5S/c1-3-21-27-19(16-29-21)15-28-11-9-17(10-12-28)13-25-22(24-4-2)26-14-18-7-5-6-8-20(18)23/h5-8,16-17H,3-4,9-15H2,1-2H3,(H2,24,25,26) |
| InChIKey | GZSZIFQBJSZVER-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|