C24H35IN6S — CID 111759640
1-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111759640) has the molecular formula C24H35IN6S and a molecular weight of 566.56 g/mol. Its IUPAC name is 1-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111759640 |
| Molecular Formula | C24H35IN6S |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | 1-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nc(CN2CCC(CN/C(=N\C)NCCc3c[nH]c4ccccc34)CC2)cs1.I |
| InChI | InChI=1S/C24H34N6S.HI/c1-3-23-29-20(17-31-23)16-30-12-9-18(10-13-30)14-28-24(25-2)26-11-8-19-15-27-22-7-5-4-6-21(19)22;/h4-7,15,17-18,27H,3,8-14,16H2,1-2H3,(H2,25,26,28);1H |
| InChIKey | FRMDOEAWOAIGDJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|