C21H30FN5S — CID 111766947
1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine (PubChem CID 111766947) has the molecular formula C21H30FN5S and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111766947 |
| Molecular Formula | C21H30FN5S |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 1-[2-(2-fluorophenyl)ethyl]-2-methyl-3-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccccc1F)NCC1CCN(Cc2csc(C)n2)CC1 |
| InChI | InChI=1S/C21H30FN5S/c1-16-26-19(15-28-16)14-27-11-8-17(9-12-27)13-25-21(23-2)24-10-7-18-5-3-4-6-20(18)22/h3-6,15,17H,7-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | BFEOWWNGFWCCAI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|