C23H34IN5OS — CID 111983136
2-methyl-1-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111983136) has the molecular formula C23H34IN5OS and a molecular weight of 555.53 g/mol. Its IUPAC name is 2-methyl-1-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111983136 |
| Molecular Formula | C23H34IN5OS |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | 2-methyl-1-[[1-[(2-methyl-1,3-thiazol-4-yl)methyl]piperidin-4-yl]methyl]-3-[(2-prop-2-enoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | C=CCOc1ccccc1CN/C(=N\C)NCC1CCN(Cc2csc(C)n2)CC1.I |
| InChI | InChI=1S/C23H33N5OS.HI/c1-4-13-29-22-8-6-5-7-20(22)15-26-23(24-3)25-14-19-9-11-28(12-10-19)16-21-17-30-18(2)27-21;/h4-8,17,19H,1,9-16H2,2-3H3,(H2,24,25,26);1H |
| InChIKey | BAMLOIUKSAQFFY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|